C11H22FNO2 — CID 143627969
1-amino-3-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxypropan-2-ol;ethane (PubChem CID 143627969) has the molecular formula C11H22FNO2 and a molecular weight of 219.30 g/mol. Its IUPAC name is 1-amino-3-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxypropan-2-ol;ethane.
| Compound Name | 1-amino-3-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxypropan-2-ol;ethane |
|---|---|
| PubChem CID | 143627969 |
| Molecular Formula | C11H22FNO2 |
| Molecular Weight | 219.30 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 1-amino-3-[(2Z,4Z)-2-fluorohexa-2,4-dien-3-yl]oxypropan-2-ol;ethane |
| SMILES | C/C=C\C(OCC(O)CN)=C(/C)F.CC |
| InChI | InChI=1S/C9H16FNO2.C2H6/c1-3-4-9(7(2)10)13-6-8(12)5-11;1-2/h3-4,8,12H,5-6,11H2,1-2H3;1-2H3/b4-3-,9-7-; |
| InChIKey | XAOQWRBHCREVQB-BNQJUYINSA-N |
| XLogP | 2.13 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|