C16H22O3 — CID 123340482
4-(1-phenylmethoxyethylidene)hept-5-ene-1,2-diol (PubChem CID 123340482) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(1-phenylmethoxyethylidene)hept-5-ene-1,2-diol.
| Compound Name | 4-(1-phenylmethoxyethylidene)hept-5-ene-1,2-diol |
|---|---|
| PubChem CID | 123340482 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 4-(1-phenylmethoxyethylidene)hept-5-ene-1,2-diol |
| SMILES | CC=CC(CC(O)CO)=C(C)OCc1ccccc1 |
| InChI | InChI=1S/C16H22O3/c1-3-7-15(10-16(18)11-17)13(2)19-12-14-8-5-4-6-9-14/h3-9,16-18H,10-12H2,1-2H3 |
| InChIKey | NLEVLNWIQBQXDW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|