C20H22O6 — CID 144596973
(Z)-5,6-dihydroxy-2,3-bis(phenylmethoxy)hex-2-enoic acid (PubChem CID 144596973) has the molecular formula C20H22O6 and a molecular weight of 358.39 g/mol. Its IUPAC name is (Z)-5,6-dihydroxy-2,3-bis(phenylmethoxy)hex-2-enoic acid.
| Compound Name | (Z)-5,6-dihydroxy-2,3-bis(phenylmethoxy)hex-2-enoic acid |
|---|---|
| PubChem CID | 144596973 |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | (Z)-5,6-dihydroxy-2,3-bis(phenylmethoxy)hex-2-enoic acid |
| SMILES | O=C(O)/C(OCc1ccccc1)=C(\CC(O)CO)OCc1ccccc1 |
| InChI | InChI=1S/C20H22O6/c21-12-17(22)11-18(25-13-15-7-3-1-4-8-15)19(20(23)24)26-14-16-9-5-2-6-10-16/h1-10,17,21-22H,11-14H2,(H,23,24)/b19-18- |
| InChIKey | SLWPZYDJBGGYBW-HNENSFHCSA-N |
| XLogP | 2.46 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|