C15H27NO2 — CID 139291179
3-aminopentadeca-7,9,12-triene-4,5-diol (PubChem CID 139291179) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 3-aminopentadeca-7,9,12-triene-4,5-diol.
| Compound Name | 3-aminopentadeca-7,9,12-triene-4,5-diol |
|---|---|
| PubChem CID | 139291179 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 3-aminopentadeca-7,9,12-triene-4,5-diol |
| SMILES | CCC=CCC=CC=CCC(O)C(O)C(N)CC |
| InChI | InChI=1S/C15H27NO2/c1-3-5-6-7-8-9-10-11-12-14(17)15(18)13(16)4-2/h5-6,8-11,13-15,17-18H,3-4,7,12,16H2,1-2H3 |
| InChIKey | ULXXMVOCGLJAIP-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|