C29H28N4O4 — CID 123803357
methyl 3-[[4-[3-[4-(4-aminophenyl)-1-methylpyrrol-2-yl]-3-oxoprop-1-enyl]-1-methylpyrrole-2-carbonyl]amino]-5-methylbenzoate (PubChem CID 123803357) has the molecular formula C29H28N4O4 and a molecular weight of 496.57 g/mol. Its IUPAC name is methyl 3-[[4-[3-[4-(4-aminophenyl)-1-methylpyrrol-2-yl]-3-oxoprop-1-enyl]-1-methylpyrrole-2-carbonyl]amino]-5-methylbenzoate.
| Compound Name | methyl 3-[[4-[3-[4-(4-aminophenyl)-1-methylpyrrol-2-yl]-3-oxoprop-1-enyl]-1-methylpyrrole-2-carbonyl]amino]-5-methylbenzoate |
|---|---|
| PubChem CID | 123803357 |
| Molecular Formula | C29H28N4O4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | methyl 3-[[4-[3-[4-(4-aminophenyl)-1-methylpyrrol-2-yl]-3-oxoprop-1-enyl]-1-methylpyrrole-2-carbonyl]amino]-5-methylbenzoate |
| SMILES | COC(=O)c1cc(C)cc(NC(=O)c2cc(C=CC(=O)c3cc(-c4ccc(N)cc4)cn3C)cn2C)c1 |
| InChI | InChI=1S/C29H28N4O4/c1-18-11-21(29(36)37-4)14-24(12-18)31-28(35)26-13-19(16-32(26)2)5-10-27(34)25-15-22(17-33(25)3)20-6-8-23(30)9-7-20/h5-17H,30H2,1-4H3,(H,31,35) |
| InChIKey | XJZKMWBAEVBKRU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 108.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|