C13H15N3O — CID 134449881
4-(4-aminophenyl)-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 134449881) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is 4-(4-aminophenyl)-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | 4-(4-aminophenyl)-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 134449881 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 4-(4-aminophenyl)-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CNC(=O)c1cc(-c2ccc(N)cc2)cn1C |
| InChI | InChI=1S/C13H15N3O/c1-15-13(17)12-7-10(8-16(12)2)9-3-5-11(14)6-4-9/h3-8H,14H2,1-2H3,(H,15,17) |
| InChIKey | NBKBINVZOZFDDG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|