C24H35N5O3 — CID 145425067
4-amino-1-methylpyrrole-2-carbaldehyde;ethane;N-(3-hydroxypropyl)-1-methyl-4-[4-(methylamino)phenyl]pyrrole-2-carboxamide (PubChem CID 145425067) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-amino-1-methylpyrrole-2-carbaldehyde;ethane;N-(3-hydroxypropyl)-1-methyl-4-[4-(methylamino)phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-methylpyrrole-2-carbaldehyde;ethane;N-(3-hydroxypropyl)-1-methyl-4-[4-(methylamino)phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 145425067 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 4-amino-1-methylpyrrole-2-carbaldehyde;ethane;N-(3-hydroxypropyl)-1-methyl-4-[4-(methylamino)phenyl]pyrrole-2-carboxamide |
| SMILES | CC.CNc1ccc(-c2cc(C(=O)NCCCO)n(C)c2)cc1.Cn1cc(N)cc1C=O |
| InChI | InChI=1S/C16H21N3O2.C6H8N2O.C2H6/c1-17-14-6-4-12(5-7-14)13-10-15(19(2)11-13)16(21)18-8-3-9-20;1-8-3-5(7)2-6(8)4-9;1-2/h4-7,10-11,17,20H,3,8-9H2,1-2H3,(H,18,21);2-4H,7H2,1H3;1-2H3 |
| InChIKey | AKJBXAQUFVMVFY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|