C7H10BN2O2 — CID 174059318
CID 174059318 (PubChem CID 174059318) has the molecular formula C7H10BN2O2 and a molecular weight of 164.98 g/mol.
| Compound Name | CID 174059318 |
|---|---|
| PubChem CID | 174059318 |
| Molecular Formula | C7H10BN2O2 |
| Molecular Weight | 164.98 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | — |
| SMILES | CNC(=O)c1cc([B]O)cn1C |
| InChI | InChI=1S/C7H10BN2O2/c1-9-7(11)6-3-5(8-12)4-10(6)2/h3-4,12H,1-2H3,(H,9,11) |
| InChIKey | UBOYJYGZRQNSCZ-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.98 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|