C11H18N4O3S — CID 43362225
N,1-dimethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxamide (PubChem CID 43362225) has the molecular formula C11H18N4O3S and a molecular weight of 286.36 g/mol. Its IUPAC name is N,1-dimethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxamide.
| Compound Name | N,1-dimethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43362225 |
| Molecular Formula | C11H18N4O3S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | N,1-dimethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)N2CCNCC2)cn1C |
| InChI | InChI=1S/C11H18N4O3S/c1-12-11(16)10-7-9(8-14(10)2)19(17,18)15-5-3-13-4-6-15/h7-8,13H,3-6H2,1-2H3,(H,12,16) |
| InChIKey | VPBDIKRCWGHLHM-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |