C11H17N3O4S — CID 61405035
1-ethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxylic acid (PubChem CID 61405035) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 1-ethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-ethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 61405035 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-ethyl-4-piperazin-1-ylsulfonylpyrrole-2-carboxylic acid |
| SMILES | CCn1cc(S(=O)(=O)N2CCNCC2)cc1C(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c1-2-13-8-9(7-10(13)11(15)16)19(17,18)14-5-3-12-4-6-14/h7-8,12H,2-6H2,1H3,(H,15,16) |
| InChIKey | GCUPIUWMZFTNEL-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |