C13H20N4O4S — CID 56808378
1-[1-methyl-5-(methylcarbamoyl)pyrrol-3-yl]sulfonylpiperidine-3-carboxamide (PubChem CID 56808378) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-[1-methyl-5-(methylcarbamoyl)pyrrol-3-yl]sulfonylpiperidine-3-carboxamide.
| Compound Name | 1-[1-methyl-5-(methylcarbamoyl)pyrrol-3-yl]sulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 56808378 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[1-methyl-5-(methylcarbamoyl)pyrrol-3-yl]sulfonylpiperidine-3-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)N2CCCC(C(N)=O)C2)cn1C |
| InChI | InChI=1S/C13H20N4O4S/c1-15-13(19)11-6-10(8-16(11)2)22(20,21)17-5-3-4-9(7-17)12(14)18/h6,8-9H,3-5,7H2,1-2H3,(H2,14,18)(H,15,19) |
| InChIKey | SWFFTXUDCWJXFG-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 114.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |