C52H39N3 — CID 123803829
2-(7,7-dimethylbenzo[g]fluoren-9-yl)-4-(9,9-diphenylfluoren-2-yl)-6-penta-2,4-dien-2-yl-1,3,5-triazine (PubChem CID 123803829) has the molecular formula C52H39N3 and a molecular weight of 705.90 g/mol. Its IUPAC name is 2-(7,7-dimethylbenzo[g]fluoren-9-yl)-4-(9,9-diphenylfluoren-2-yl)-6-penta-2,4-dien-2-yl-1,3,5-triazine.
| Compound Name | 2-(7,7-dimethylbenzo[g]fluoren-9-yl)-4-(9,9-diphenylfluoren-2-yl)-6-penta-2,4-dien-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 123803829 |
| Molecular Formula | C52H39N3 |
| Molecular Weight | 705.90 g/mol |
| Exact Mass | 705.31 |
| IUPAC Name | 2-(7,7-dimethylbenzo[g]fluoren-9-yl)-4-(9,9-diphenylfluoren-2-yl)-6-penta-2,4-dien-2-yl-1,3,5-triazine |
| SMILES | C=CC=C(C)c1nc(-c2ccc3c(c2)C(C)(C)c2ccc4ccccc4c2-3)nc(-c2ccc3c(c2)C(c2ccccc2)(c2ccccc2)c2ccccc2-3)n1 |
| InChI | InChI=1S/C52H39N3/c1-5-16-33(2)48-53-49(35-26-29-42-45(31-35)51(3,4)44-30-27-34-17-12-13-22-39(34)47(42)44)55-50(54-48)36-25-28-41-40-23-14-15-24-43(40)52(46(41)32-36,37-18-8-6-9-19-37)38-20-10-7-11-21-38/h5-32H,1H2,2-4H3 |
| InChIKey | ZGMCHUYMNUSRDR-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.90 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|