C39H32N2Si — CID 123804278
5-tert-butyl-17,17-dimethyl-9-pyridin-3-yl-9-aza-17-silaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18,20,22,25,27-tetradecaene (PubChem CID 123804278) has the molecular formula C39H32N2Si and a molecular weight of 556.79 g/mol. Its IUPAC name is 5-tert-butyl-17,17-dimethyl-9-pyridin-3-yl-9-aza-17-silaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18,20,22,25,27-tetradecaene.
| Compound Name | 5-tert-butyl-17,17-dimethyl-9-pyridin-3-yl-9-aza-17-silaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18,20,22,25,27-tetradecaene |
|---|---|
| PubChem CID | 123804278 |
| Molecular Formula | C39H32N2Si |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | 5-tert-butyl-17,17-dimethyl-9-pyridin-3-yl-9-aza-17-silaoctacyclo[13.13.2.02,10.03,8.012,29.016,24.018,23.026,30]triaconta-1(29),2(10),3(8),4,6,11,13,15(30),16(24),18,20,22,25,27-tetradecaene |
| SMILES | CC(C)(C)c1ccc2c(c1)c1c3ccc4cc5c(c6ccc(cc1n2-c1cccnc1)c3c46)[Si](C)(C)c1ccccc1-5 |
| InChI | InChI=1S/C39H32N2Si/c1-39(2,3)25-14-17-32-31(21-25)37-28-15-12-23-19-30-27-10-6-7-11-34(27)42(4,5)38(30)29-16-13-24(35(28)36(23)29)20-33(37)41(32)26-9-8-18-40-22-26/h6-22H,1-5H3 |
| InChIKey | JRSSVWOJCMMKMP-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|