C22H22N2O8 — CID 123804912
dimethyl 2-[5-[(1,4-dimethoxy-1,4-dioxobutan-2-ylidene)amino]naphthalen-1-yl]iminobutanedioate (PubChem CID 123804912) has the molecular formula C22H22N2O8 and a molecular weight of 442.42 g/mol. Its IUPAC name is dimethyl 2-[5-[(1,4-dimethoxy-1,4-dioxobutan-2-ylidene)amino]naphthalen-1-yl]iminobutanedioate.
| Compound Name | dimethyl 2-[5-[(1,4-dimethoxy-1,4-dioxobutan-2-ylidene)amino]naphthalen-1-yl]iminobutanedioate |
|---|---|
| PubChem CID | 123804912 |
| Molecular Formula | C22H22N2O8 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | dimethyl 2-[5-[(1,4-dimethoxy-1,4-dioxobutan-2-ylidene)amino]naphthalen-1-yl]iminobutanedioate |
| SMILES | COC(=O)C/C(=N\c1cccc2c(/N=C(\CC(=O)OC)C(=O)OC)cccc12)C(=O)OC |
| InChI | InChI=1S/C22H22N2O8/c1-29-19(25)11-17(21(27)31-3)23-15-9-5-8-14-13(15)7-6-10-16(14)24-18(22(28)32-4)12-20(26)30-2/h5-10H,11-12H2,1-4H3/b23-17+,24-18+ |
| InChIKey | BWJCOQIPUAVURO-GJHDBBOXSA-N |
| XLogP | 2.46 |
| TPSA | 129.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|