C13H12N2O6 — CID 91308349
dimethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)imino]butanedioate (PubChem CID 91308349) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is dimethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)imino]butanedioate.
| Compound Name | dimethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)imino]butanedioate |
|---|---|
| PubChem CID | 91308349 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | dimethyl 2-[(2-oxo-3H-1,3-benzoxazol-6-yl)imino]butanedioate |
| SMILES | COC(=O)C/C(=N\c1ccc2[nH]c(=O)oc2c1)C(=O)OC |
| InChI | InChI=1S/C13H12N2O6/c1-19-11(16)6-9(12(17)20-2)14-7-3-4-8-10(5-7)21-13(18)15-8/h3-5H,6H2,1-2H3,(H,15,18)/b14-9+ |
| InChIKey | KLMIVKOKWICRFB-NTEUORMPSA-N |
| XLogP | 0.93 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|