C23H22N2O3 — CID 123805016
8-methoxy-9-(2-methylidenepent-3-enoxy)-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one (PubChem CID 123805016) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 8-methoxy-9-(2-methylidenepent-3-enoxy)-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one.
| Compound Name | 8-methoxy-9-(2-methylidenepent-3-enoxy)-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 123805016 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 8-methoxy-9-(2-methylidenepent-3-enoxy)-12a,13-dihydroindolo[2,1-c][1,4]benzodiazepin-6-one |
| SMILES | C=C(C=CC)COc1cc2c(cc1OC)C(=O)N1c3ccccc3CC1C=N2 |
| InChI | InChI=1S/C23H22N2O3/c1-4-7-15(2)14-28-22-12-19-18(11-21(22)27-3)23(26)25-17(13-24-19)10-16-8-5-6-9-20(16)25/h4-9,11-13,17H,2,10,14H2,1,3H3 |
| InChIKey | MLKAMWMNKAYBFV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|