C19H14ClF7N2S — CID 123805487
6-[2-chloro-5-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2,5]thiadiazole (PubChem CID 123805487) has the molecular formula C19H14ClF7N2S and a molecular weight of 470.84 g/mol. Its IUPAC name is 6-[2-chloro-5-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2,5]thiadiazole.
| Compound Name | 6-[2-chloro-5-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2,5]thiadiazole |
|---|---|
| PubChem CID | 123805487 |
| Molecular Formula | C19H14ClF7N2S |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 6-[2-chloro-5-(trifluoromethyl)phenyl]-3-[3-fluoro-5-(trifluoromethyl)phenyl]-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2,5]thiadiazole |
| SMILES | Fc1cc(C2NSN3C(c4cc(C(F)(F)F)ccc4Cl)CCC23)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14ClF7N2S/c20-14-2-1-10(18(22,23)24)8-13(14)15-3-4-16-17(28-30-29(15)16)9-5-11(19(25,26)27)7-12(21)6-9/h1-2,5-8,15-17,28H,3-4H2 |
| InChIKey | PNTKDRVHJWMTDS-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|