C10H16 — CID 123806076
4-methylnona-1,2,8-triene (PubChem CID 123806076) has the molecular formula C10H16 and a molecular weight of 136.24 g/mol. Its IUPAC name is 4-methylnona-1,2,8-triene.
| Compound Name | 4-methylnona-1,2,8-triene |
|---|---|
| PubChem CID | 123806076 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | 4-methylnona-1,2,8-triene |
| SMILES | C=C=CC(C)CCCC=C |
| InChI | InChI=1S/C10H16/c1-4-6-7-9-10(3)8-5-2/h4,8,10H,1-2,6-7,9H2,3H3 |
| InChIKey | PGPFSMQYENWLQR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|