About 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine
7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 123806825) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine.
Analyze 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine?
The IUPAC name of 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine (CID 123806825) is 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine.
What is the SMILES notation for 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine?
The canonical SMILES for 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine is CC1C=Cn2cnnc2C1.
What is the InChIKey of 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine?
The InChIKey is IAAYHTNFGZRMSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-6-2-3-10-5-8-9-7(10)4-6/h2-3,5-6H,4H2,1H3.
What are the key properties of 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine?
7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine has a molecular weight of 135.17 g/mol, XLogP of 0.94, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-7,8-dihydro-[1,2,4]triazolo[4,3-a]pyridine is sourced from PubChem (CID 123806825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).