C11H17N3 — CID 123994001
1-(2-ethylbuta-1,3-dienyl)-5-propyl-1,2,4-triazole (PubChem CID 123994001) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-(2-ethylbuta-1,3-dienyl)-5-propyl-1,2,4-triazole.
| Compound Name | 1-(2-ethylbuta-1,3-dienyl)-5-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 123994001 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-(2-ethylbuta-1,3-dienyl)-5-propyl-1,2,4-triazole |
| SMILES | C=CC(=Cn1ncnc1CCC)CC |
| InChI | InChI=1S/C11H17N3/c1-4-7-11-12-9-13-14(11)8-10(5-2)6-3/h5,8-9H,2,4,6-7H2,1,3H3 |
| InChIKey | CFWZWLZEPDPHEN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|