C13H21N3 — CID 123513251
3-(6-ethylocta-4,6-dienyl)-1-methyl-1,2,4-triazole (PubChem CID 123513251) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 3-(6-ethylocta-4,6-dienyl)-1-methyl-1,2,4-triazole.
| Compound Name | 3-(6-ethylocta-4,6-dienyl)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 123513251 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 3-(6-ethylocta-4,6-dienyl)-1-methyl-1,2,4-triazole |
| SMILES | CC=C(C=CCCCc1ncn(C)n1)CC |
| InChI | InChI=1S/C13H21N3/c1-4-12(5-2)9-7-6-8-10-13-14-11-16(3)15-13/h4,7,9,11H,5-6,8,10H2,1-3H3 |
| InChIKey | ORYWMTYXIHWYJJ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|