C12H14LiN3 — CID 58162940
lithium 1-methyl-5-phenyl-3-propyl-1,2,4-triazole (PubChem CID 58162940) has the molecular formula C12H14LiN3 and a molecular weight of 207.21 g/mol. Its IUPAC name is lithium 1-methyl-5-phenyl-3-propyl-1,2,4-triazole.
| Compound Name | lithium 1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58162940 |
| Molecular Formula | C12H14LiN3 |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | lithium 1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
| SMILES | CCCc1nc(-c2[c-]cccc2)n(C)n1.[Li+] |
| InChI | InChI=1S/C12H14N3.Li/c1-3-7-11-13-12(15(2)14-11)10-8-5-4-6-9-10;/h4-6,8H,3,7H2,1-2H3;/q-1;+1 |
| InChIKey | FSHGYWDKBRKELG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|