C12H12F2IrN3- — CID 59165289
5-(2,4-difluorobenzene-6-id-1-yl)-1-methyl-3-propyl-1,2,4-triazole;iridium (PubChem CID 59165289) has the molecular formula C12H12F2IrN3- and a molecular weight of 428.46 g/mol. Its IUPAC name is 5-(2,4-difluorobenzene-6-id-1-yl)-1-methyl-3-propyl-1,2,4-triazole;iridium.
| Compound Name | 5-(2,4-difluorobenzene-6-id-1-yl)-1-methyl-3-propyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 59165289 |
| Molecular Formula | C12H12F2IrN3- |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-(2,4-difluorobenzene-6-id-1-yl)-1-methyl-3-propyl-1,2,4-triazole;iridium |
| SMILES | CCCc1nc(-c2[c-]cc(F)cc2F)n(C)n1.[Ir] |
| InChI | InChI=1S/C12H12F2N3.Ir/c1-3-4-11-15-12(17(2)16-11)9-6-5-8(13)7-10(9)14;/h5,7H,3-4H2,1-2H3;/q-1; |
| InChIKey | ZJTLIUCNHZBULT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|