C14H16F2IrN3- — CID 58426447
4-tert-butyl-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium (PubChem CID 58426447) has the molecular formula C14H16F2IrN3- and a molecular weight of 456.52 g/mol. Its IUPAC name is 4-tert-butyl-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium.
| Compound Name | 4-tert-butyl-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 58426447 |
| Molecular Formula | C14H16F2IrN3- |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 4-tert-butyl-3-(1,1-difluoroethyl)-5-phenyl-1,2,4-triazole;iridium |
| SMILES | CC(F)(F)c1nnc(-c2[c-]cccc2)n1C(C)(C)C.[Ir] |
| InChI | InChI=1S/C14H16F2N3.Ir/c1-13(2,3)19-11(10-8-6-5-7-9-10)17-18-12(19)14(4,15)16;/h5-8H,1-4H3;/q-1; |
| InChIKey | OYNAEZHROYGSMV-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|