C13H16IrN3- — CID 58426424
4-tert-butyl-3-methyl-5-phenyl-1,2,4-triazole;iridium (PubChem CID 58426424) has the molecular formula C13H16IrN3- and a molecular weight of 406.51 g/mol. Its IUPAC name is 4-tert-butyl-3-methyl-5-phenyl-1,2,4-triazole;iridium.
| Compound Name | 4-tert-butyl-3-methyl-5-phenyl-1,2,4-triazole;iridium |
|---|---|
| PubChem CID | 58426424 |
| Molecular Formula | C13H16IrN3- |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 4-tert-butyl-3-methyl-5-phenyl-1,2,4-triazole;iridium |
| SMILES | Cc1nnc(-c2[c-]cccc2)n1C(C)(C)C.[Ir] |
| InChI | InChI=1S/C13H16N3.Ir/c1-10-14-15-12(16(10)13(2,3)4)11-8-6-5-7-9-11;/h5-8H,1-4H3;/q-1; |
| InChIKey | QTSUIIVCSFRGQI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|