C9H8IrN3- — CID 59661348
iridium;4-methyl-3-phenyl-1,2,4-triazole (PubChem CID 59661348) has the molecular formula C9H8IrN3- and a molecular weight of 350.40 g/mol. Its IUPAC name is iridium;4-methyl-3-phenyl-1,2,4-triazole.
| Compound Name | iridium;4-methyl-3-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 59661348 |
| Molecular Formula | C9H8IrN3- |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | iridium;4-methyl-3-phenyl-1,2,4-triazole |
| SMILES | Cn1cnnc1-c1[c-]cccc1.[Ir] |
| InChI | InChI=1S/C9H8N3.Ir/c1-12-7-10-11-9(12)8-5-3-2-4-6-8;/h2-5,7H,1H3;/q-1; |
| InChIKey | JMZKWBZBPRFUAH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|