C12H14IrN3- — CID 58162909
iridium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole (PubChem CID 58162909) has the molecular formula C12H14IrN3- and a molecular weight of 392.48 g/mol. Its IUPAC name is iridium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole.
| Compound Name | iridium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58162909 |
| Molecular Formula | C12H14IrN3- |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | iridium;1-methyl-5-phenyl-3-propyl-1,2,4-triazole |
| SMILES | CCCc1nc(-c2[c-]cccc2)n(C)n1.[Ir] |
| InChI | InChI=1S/C12H14N3.Ir/c1-3-7-11-13-12(15(2)14-11)10-8-5-4-6-9-10;/h4-6,8H,3,7H2,1-2H3;/q-1; |
| InChIKey | QISSBMMJFZMSDC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|