C14H18IrN3- — CID 58240206
iridium;3-phenyl-4,5-dipropyl-1,2,4-triazole (PubChem CID 58240206) has the molecular formula C14H18IrN3- and a molecular weight of 420.54 g/mol. Its IUPAC name is iridium;3-phenyl-4,5-dipropyl-1,2,4-triazole.
| Compound Name | iridium;3-phenyl-4,5-dipropyl-1,2,4-triazole |
|---|---|
| PubChem CID | 58240206 |
| Molecular Formula | C14H18IrN3- |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | iridium;3-phenyl-4,5-dipropyl-1,2,4-triazole |
| SMILES | CCCc1nnc(-c2[c-]cccc2)n1CCC.[Ir] |
| InChI | InChI=1S/C14H18N3.Ir/c1-3-8-13-15-16-14(17(13)11-4-2)12-9-6-5-7-10-12;/h5-7,9H,3-4,8,11H2,1-2H3;/q-1; |
| InChIKey | INQXCYXIMQZFAP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|