C12H10IrN3- — CID 58517831
3,5-dimethyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide;iridium (PubChem CID 58517831) has the molecular formula C12H10IrN3- and a molecular weight of 388.45 g/mol. Its IUPAC name is 3,5-dimethyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide;iridium.
| Compound Name | 3,5-dimethyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide;iridium |
|---|---|
| PubChem CID | 58517831 |
| Molecular Formula | C12H10IrN3- |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3,5-dimethyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide;iridium |
| SMILES | Cc1cc2ccc[c-]c2c2nnc(C)n12.[Ir] |
| InChI | InChI=1S/C12H10N3.Ir/c1-8-7-10-5-3-4-6-11(10)12-14-13-9(2)15(8)12;/h3-5,7H,1-2H3;/q-1; |
| InChIKey | FLKLOXMARHHRKS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|