C12H7IrN4- — CID 58518001
iridium;7-isocyano-3-methyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide (PubChem CID 58518001) has the molecular formula C12H7IrN4- and a molecular weight of 399.43 g/mol. Its IUPAC name is iridium;7-isocyano-3-methyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide.
| Compound Name | iridium;7-isocyano-3-methyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide |
|---|---|
| PubChem CID | 58518001 |
| Molecular Formula | C12H7IrN4- |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | iridium;7-isocyano-3-methyl-10H-[1,2,4]triazolo[3,4-a]isoquinolin-10-ide |
| SMILES | [C-]#[N+]c1cc[c-]c2c1ccn1c(C)nnc21.[Ir] |
| InChI | InChI=1S/C12H7N4.Ir/c1-8-14-15-12-10-4-3-5-11(13-2)9(10)6-7-16(8)12;/h3,5-7H,1H3;/q-1; |
| InChIKey | MCERNWOWEMPGOJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|