C9H5IrN4- — CID 58517814
iridium;10H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-10-ide (PubChem CID 58517814) has the molecular formula C9H5IrN4- and a molecular weight of 361.38 g/mol. Its IUPAC name is iridium;10H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-10-ide.
| Compound Name | iridium;10H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-10-ide |
|---|---|
| PubChem CID | 58517814 |
| Molecular Formula | C9H5IrN4- |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | iridium;10H-[1,2,4]triazolo[3,4-f][1,6]naphthyridin-10-ide |
| SMILES | [Ir].[c-]1ccnc2ccn3cnnc3c12 |
| InChI | InChI=1S/C9H5N4.Ir/c1-2-7-8(10-4-1)3-5-13-6-11-12-9(7)13;/h1,3-6H;/q-1; |
| InChIKey | DGHAEJYIPVLXQX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|