C11H8IrN3- — CID 58517956
iridium;2-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide (PubChem CID 58517956) has the molecular formula C11H8IrN3- and a molecular weight of 374.42 g/mol. Its IUPAC name is iridium;2-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide.
| Compound Name | iridium;2-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide |
|---|---|
| PubChem CID | 58517956 |
| Molecular Formula | C11H8IrN3- |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | iridium;2-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide |
| SMILES | Cc1nc2c3[c-]cccc3ccn2n1.[Ir] |
| InChI | InChI=1S/C11H8N3.Ir/c1-8-12-11-10-5-3-2-4-9(10)6-7-14(11)13-8;/h2-4,6-7H,1H3;/q-1; |
| InChIKey | HCFCHMVKFXSOHS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|