C10H6IrN3- — CID 58517693
iridium;9H-[1,2,4]triazolo[1,5-a]quinolin-9-ide (PubChem CID 58517693) has the molecular formula C10H6IrN3- and a molecular weight of 360.40 g/mol. Its IUPAC name is iridium;9H-[1,2,4]triazolo[1,5-a]quinolin-9-ide.
| Compound Name | iridium;9H-[1,2,4]triazolo[1,5-a]quinolin-9-ide |
|---|---|
| PubChem CID | 58517693 |
| Molecular Formula | C10H6IrN3- |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | iridium;9H-[1,2,4]triazolo[1,5-a]quinolin-9-ide |
| SMILES | [Ir].[c-]1cccc2ccc3ncnn3c12 |
| InChI | InChI=1S/C10H6N3.Ir/c1-2-4-9-8(3-1)5-6-10-11-7-12-13(9)10;/h1-3,5-7H;/q-1; |
| InChIKey | BEDSNBRVHIOJHQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|