C11H5IrN4- — CID 58517983
iridium;7-isocyano-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide (PubChem CID 58517983) has the molecular formula C11H5IrN4- and a molecular weight of 385.41 g/mol. Its IUPAC name is iridium;7-isocyano-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide.
| Compound Name | iridium;7-isocyano-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide |
|---|---|
| PubChem CID | 58517983 |
| Molecular Formula | C11H5IrN4- |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 386.01 |
| IUPAC Name | iridium;7-isocyano-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide |
| SMILES | [C-]#[N+]c1cc[c-]c2c1ccn1ncnc21.[Ir] |
| InChI | InChI=1S/C11H5N4.Ir/c1-12-10-4-2-3-9-8(10)5-6-15-11(9)13-7-14-15;/h2,4-7H;/q-1; |
| InChIKey | KZGCLKHEEBORKM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 34.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|