C11H8N3Pt- — CID 58517530
6-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide;platinum (PubChem CID 58517530) has the molecular formula C11H8N3Pt- and a molecular weight of 377.28 g/mol. Its IUPAC name is 6-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide;platinum.
| Compound Name | 6-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide;platinum |
|---|---|
| PubChem CID | 58517530 |
| Molecular Formula | C11H8N3Pt- |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | 6-methyl-10H-[1,2,4]triazolo[5,1-a]isoquinolin-10-ide;platinum |
| SMILES | Cc1cn2ncnc2c2[c-]cccc12.[Pt] |
| InChI | InChI=1S/C11H8N3.Pt/c1-8-6-14-11(12-7-13-14)10-5-3-2-4-9(8)10;/h2-4,6-7H,1H3;/q-1; |
| InChIKey | CZPVDHCIYWCLPS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|