About 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine
2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 59299738) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine.
Analyze 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The IUPAC name of 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine (CID 59299738) is 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine.
What is the SMILES notation for 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The canonical SMILES for 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine is Cc1nc2n(n1)CCC=C2.
What is the InChIKey of 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
The InChIKey is KIYPWMOVZIBTPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-6-8-7-4-2-3-5-10(7)9-6/h2,4H,3,5H2,1H3.
What are the key properties of 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine?
2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine has a molecular weight of 135.17 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5,6-dihydro-[1,2,4]triazolo[1,5-a]pyridine is sourced from PubChem (CID 59299738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).