C15H20ClMgN3 — CID 58163012
magnesium;5-(2,2-dimethylpropyl)-1-methyl-3-(3-methylbenzene-6-id-1-yl)-1,2,4-triazole;chloride (PubChem CID 58163012) has the molecular formula C15H20ClMgN3 and a molecular weight of 302.10 g/mol. Its IUPAC name is magnesium;5-(2,2-dimethylpropyl)-1-methyl-3-(3-methylbenzene-6-id-1-yl)-1,2,4-triazole;chloride.
| Compound Name | magnesium;5-(2,2-dimethylpropyl)-1-methyl-3-(3-methylbenzene-6-id-1-yl)-1,2,4-triazole;chloride |
|---|---|
| PubChem CID | 58163012 |
| Molecular Formula | C15H20ClMgN3 |
| Molecular Weight | 302.10 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | magnesium;5-(2,2-dimethylpropyl)-1-methyl-3-(3-methylbenzene-6-id-1-yl)-1,2,4-triazole;chloride |
| SMILES | Cc1cc[c-]c(-c2nc(CC(C)(C)C)n(C)n2)c1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C15H20N3.ClH.Mg/c1-11-7-6-8-12(9-11)14-16-13(18(5)17-14)10-15(2,3)4;;/h6-7,9H,10H2,1-5H3;1H;/q-1;;+2/p-1 |
| InChIKey | LYTOLGGFPVPPEU-UHFFFAOYSA-M |
| XLogP | -0.20 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.10 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|