C13H21N3 — CID 123155448
4-(6-methylhepta-4,6-dienyl)-3-propyl-1,2,4-triazole (PubChem CID 123155448) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-(6-methylhepta-4,6-dienyl)-3-propyl-1,2,4-triazole.
| Compound Name | 4-(6-methylhepta-4,6-dienyl)-3-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 123155448 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | 4-(6-methylhepta-4,6-dienyl)-3-propyl-1,2,4-triazole |
| SMILES | C=C(C)C=CCCCn1cnnc1CCC |
| InChI | InChI=1S/C13H21N3/c1-4-8-13-15-14-11-16(13)10-7-5-6-9-12(2)3/h6,9,11H,2,4-5,7-8,10H2,1,3H3 |
| InChIKey | BWQRTHJTQDSMGH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|