C14H22N4 — CID 123288397
N,4,5-trimethyl-N-nona-3,5,8-trienyl-1,2,4-triazol-3-amine (PubChem CID 123288397) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is N,4,5-trimethyl-N-nona-3,5,8-trienyl-1,2,4-triazol-3-amine.
| Compound Name | N,4,5-trimethyl-N-nona-3,5,8-trienyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 123288397 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | N,4,5-trimethyl-N-nona-3,5,8-trienyl-1,2,4-triazol-3-amine |
| SMILES | C=CCC=CC=CCCN(C)c1nnc(C)n1C |
| InChI | InChI=1S/C14H22N4/c1-5-6-7-8-9-10-11-12-17(3)14-16-15-13(2)18(14)4/h5,7-10H,1,6,11-12H2,2-4H3 |
| InChIKey | XTDFQKMTXLGWST-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|