C11H21N3 — CID 142548519
3,5-dimethyl-1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole;ethane (PubChem CID 142548519) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 3,5-dimethyl-1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole;ethane.
| Compound Name | 3,5-dimethyl-1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole;ethane |
|---|---|
| PubChem CID | 142548519 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 3,5-dimethyl-1-[(Z)-pent-3-en-2-yl]-1,2,4-triazole;ethane |
| SMILES | C/C=C\C(C)n1nc(C)nc1C.CC |
| InChI | InChI=1S/C9H15N3.C2H6/c1-5-6-7(2)12-9(4)10-8(3)11-12;1-2/h5-7H,1-4H3;1-2H3/b6-5-; |
| InChIKey | MBAIXYMKXYLVKW-YSMBQZINSA-N |
| XLogP | 3.06 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|