C12H20FN3 — CID 142140843
3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole;(Z)-1-fluorobut-2-ene (PubChem CID 142140843) has the molecular formula C12H20FN3 and a molecular weight of 225.31 g/mol. Its IUPAC name is 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole;(Z)-1-fluorobut-2-ene.
| Compound Name | 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole;(Z)-1-fluorobut-2-ene |
|---|---|
| PubChem CID | 142140843 |
| Molecular Formula | C12H20FN3 |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.16 |
| IUPAC Name | 3-[(E)-but-1-enyl]-4,5-dimethyl-1,2,4-triazole;(Z)-1-fluorobut-2-ene |
| SMILES | C/C=C\CF.CC/C=C/c1nnc(C)n1C |
| InChI | InChI=1S/C8H13N3.C4H7F/c1-4-5-6-8-10-9-7(2)11(8)3;1-2-3-4-5/h5-6H,4H2,1-3H3;2-3H,4H2,1H3/b6-5+;3-2- |
| InChIKey | KNNFYVBFGPWFQZ-JDZBGVRNSA-N |
| XLogP | 3.08 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|