C9H15N3 — CID 57189602
3,4-diethyl-5-[(E)-prop-1-enyl]-1,2,4-triazole (PubChem CID 57189602) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 3,4-diethyl-5-[(E)-prop-1-enyl]-1,2,4-triazole.
| Compound Name | 3,4-diethyl-5-[(E)-prop-1-enyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 57189602 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3,4-diethyl-5-[(E)-prop-1-enyl]-1,2,4-triazole |
| SMILES | C/C=C/c1nnc(CC)n1CC |
| InChI | InChI=1S/C9H15N3/c1-4-7-9-11-10-8(5-2)12(9)6-3/h4,7H,5-6H2,1-3H3/b7-4+ |
| InChIKey | KCVMHMVCNKZHPS-QPJJXVBHSA-N |
| XLogP | 1.89 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |