About (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate
(4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate (PubChem CID 123808120) has the molecular formula C20H26O3
and a molecular weight of 314.43 g/mol. Its IUPAC name is (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate.
Molecular Properties
| Compound Name | (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate |
| PubChem CID | 123808120 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate |
| SMILES | Cc1ccc(COC(=O)CCCC2CC3CCC(C3)C2=O)cc1 |
| InChI | InChI=1S/C20H26O3/c1-14-5-7-15(8-6-14)13-23-19(21)4-2-3-17-11-16-9-10-18(12-16)20(17)22/h5-8,16-18H,2-4,9-13H2,1H3 |
| InChIKey | BKRLGJYSVZTECT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate?
The IUPAC name of (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate (CID 123808120) is (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate.
What is the SMILES notation for (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate?
The canonical SMILES for (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate is Cc1ccc(COC(=O)CCCC2CC3CCC(C3)C2=O)cc1.
What is the InChIKey of (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate?
The InChIKey is BKRLGJYSVZTECT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O3/c1-14-5-7-15(8-6-14)13-23-19(21)4-2-3-17-11-16-9-10-18(12-16)20(17)22/h5-8,16-18H,2-4,9-13H2,1H3.
What are the key properties of (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate?
(4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate has a molecular weight of 314.43 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)methyl 4-(2-oxo-3-bicyclo[3.2.1]octanyl)butanoate is sourced from PubChem (CID 123808120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).