C20H21ClN2O — CID 123808415
1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydrocycloocta[c]pyrazole (PubChem CID 123808415) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydrocycloocta[c]pyrazole.
| Compound Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydrocycloocta[c]pyrazole |
|---|---|
| PubChem CID | 123808415 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(oxan-4-yl)-7,8-dihydrocycloocta[c]pyrazole |
| SMILES | Clc1ccc(-n2nc(C3CCOCC3)c3c2=CCCC=CC=3)cc1 |
| InChI | InChI=1S/C20H21ClN2O/c21-16-7-9-17(10-8-16)23-19-6-4-2-1-3-5-18(19)20(22-23)15-11-13-24-14-12-15/h1,3,5-10,15H,2,4,11-14H2 |
| InChIKey | VSOCNCWWVGKYDE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |