C18H19ClFN3O — CID 147321759
1-(4-chlorophenyl)-5-fluoro-6-methyl-3-(oxan-4-yl)-5H-pyrazolo[3,4-c]pyridine (PubChem CID 147321759) has the molecular formula C18H19ClFN3O and a molecular weight of 347.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-fluoro-6-methyl-3-(oxan-4-yl)-5H-pyrazolo[3,4-c]pyridine.
| Compound Name | 1-(4-chlorophenyl)-5-fluoro-6-methyl-3-(oxan-4-yl)-5H-pyrazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 147321759 |
| Molecular Formula | C18H19ClFN3O |
| Molecular Weight | 347.82 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 1-(4-chlorophenyl)-5-fluoro-6-methyl-3-(oxan-4-yl)-5H-pyrazolo[3,4-c]pyridine |
| SMILES | CN1C=c2c(c(C3CCOCC3)nn2-c2ccc(Cl)cc2)=CC1F |
| InChI | InChI=1S/C18H19ClFN3O/c1-22-11-16-15(10-17(22)20)18(12-6-8-24-9-7-12)21-23(16)14-4-2-13(19)3-5-14/h2-5,10-12,17H,6-9H2,1H3 |
| InChIKey | CZYBXVUABXWONE-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|