C17H22ClN3O — CID 123218003
2-(2-chlorophenyl)-5-(3-ethoxypropyl)-6,7-dihydro-3H-pyrazolo[4,3-c]pyridine (PubChem CID 123218003) has the molecular formula C17H22ClN3O and a molecular weight of 319.84 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5-(3-ethoxypropyl)-6,7-dihydro-3H-pyrazolo[4,3-c]pyridine.
| Compound Name | 2-(2-chlorophenyl)-5-(3-ethoxypropyl)-6,7-dihydro-3H-pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 123218003 |
| Molecular Formula | C17H22ClN3O |
| Molecular Weight | 319.84 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(2-chlorophenyl)-5-(3-ethoxypropyl)-6,7-dihydro-3H-pyrazolo[4,3-c]pyridine |
| SMILES | CCOCCCN1C=C2CN(c3ccccc3Cl)N=C2CC1 |
| InChI | InChI=1S/C17H22ClN3O/c1-2-22-11-5-9-20-10-8-16-14(12-20)13-21(19-16)17-7-4-3-6-15(17)18/h3-4,6-7,12H,2,5,8-11,13H2,1H3 |
| InChIKey | LAZKKORIOJYVAE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.84 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|