C9H12 — CID 123809086
6-ethyl-1-methylcyclohexa-1,2,4-triene (PubChem CID 123809086) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 6-ethyl-1-methylcyclohexa-1,2,4-triene.
| Compound Name | 6-ethyl-1-methylcyclohexa-1,2,4-triene |
|---|---|
| PubChem CID | 123809086 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 6-ethyl-1-methylcyclohexa-1,2,4-triene |
| SMILES | CCC1C=CC=C=C1C |
| InChI | InChI=1S/C9H12/c1-3-9-7-5-4-6-8(9)2/h4-5,7,9H,3H2,1-2H3 |
| InChIKey | GIKLXBZQAHDJHF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |