About trityloxysilane
trityloxysilane (PubChem CID 123809456) has the molecular formula C19H18OSi
and a molecular weight of 290.44 g/mol. Its IUPAC name is trityloxysilane.
Molecular Properties
| Compound Name | trityloxysilane |
| PubChem CID | 123809456 |
| Molecular Formula | C19H18OSi |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | trityloxysilane |
| SMILES | [SiH3]OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18OSi/c21-20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,21H3 |
| InChIKey | XMTVPWPWVYPLDO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trityloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trityloxysilane?
The IUPAC name of trityloxysilane (CID 123809456) is trityloxysilane.
What is the SMILES notation for trityloxysilane?
The canonical SMILES for trityloxysilane is [SiH3]OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of trityloxysilane?
The InChIKey is XMTVPWPWVYPLDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18OSi/c21-20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,21H3.
What are the key properties of trityloxysilane?
trityloxysilane has a molecular weight of 290.44 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trityloxysilane is sourced from PubChem (CID 123809456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).