About ditrityloxytin
ditrityloxytin (PubChem CID 177426168) has the molecular formula C38H30O2Sn
and a molecular weight of 637.37 g/mol. Its IUPAC name is ditrityloxytin.
Molecular Properties
| Compound Name | ditrityloxytin |
| PubChem CID | 177426168 |
| Molecular Formula | C38H30O2Sn |
| Molecular Weight | 637.37 g/mol |
| Exact Mass | 638.13 |
| IUPAC Name | ditrityloxytin |
| SMILES | c1ccc(C(O[Sn]OC(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/2C19H15O.Sn/c2*20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;/q2*-1;+2 |
| InChIKey | ZXJGGHMAXTUQJJ-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 637.37 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ditrityloxytin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditrityloxytin?
The IUPAC name of ditrityloxytin (CID 177426168) is ditrityloxytin.
What is the SMILES notation for ditrityloxytin?
The canonical SMILES for ditrityloxytin is c1ccc(C(O[Sn]OC(c2ccccc2)(c2ccccc2)c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of ditrityloxytin?
The InChIKey is ZXJGGHMAXTUQJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C19H15O.Sn/c2*20-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h2*1-15H;/q2*-1;+2.
What are the key properties of ditrityloxytin?
ditrityloxytin has a molecular weight of 637.37 g/mol, XLogP of 8.54, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ditrityloxytin is sourced from PubChem (CID 177426168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).