About fluoro(trityloxy)borinic acid
fluoro(trityloxy)borinic acid (PubChem CID 53443390) has the molecular formula C19H16BFO2
and a molecular weight of 306.15 g/mol. Its IUPAC name is fluoro(trityloxy)borinic acid.
Molecular Properties
| Compound Name | fluoro(trityloxy)borinic acid |
| PubChem CID | 53443390 |
| Molecular Formula | C19H16BFO2 |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | fluoro(trityloxy)borinic acid |
| SMILES | OB(F)OC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16BFO2/c21-20(22)23-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,22H |
| InChIKey | QTXVPGNGLWGPIM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze fluoro(trityloxy)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro(trityloxy)borinic acid?
The IUPAC name of fluoro(trityloxy)borinic acid (CID 53443390) is fluoro(trityloxy)borinic acid.
What is the SMILES notation for fluoro(trityloxy)borinic acid?
The canonical SMILES for fluoro(trityloxy)borinic acid is OB(F)OC(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of fluoro(trityloxy)borinic acid?
The InChIKey is QTXVPGNGLWGPIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16BFO2/c21-20(22)23-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,22H.
What are the key properties of fluoro(trityloxy)borinic acid?
fluoro(trityloxy)borinic acid has a molecular weight of 306.15 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro(trityloxy)borinic acid is sourced from PubChem (CID 53443390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).